C22H23N2O2S+ — CID 9360271
N-(2-phenoxyphenyl)-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]acetamide (PubChem CID 9360271) has the molecular formula C22H23N2O2S+ and a molecular weight of 379.50 g/mol. Its IUPAC name is N-(2-phenoxyphenyl)-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]acetamide.
| Compound Name | N-(2-phenoxyphenyl)-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 9360271 |
| Molecular Formula | C22H23N2O2S+ |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | N-(2-phenoxyphenyl)-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]acetamide |
| SMILES | O=C(C[NH+]1CCC[C@@H]1c1cccs1)Nc1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C22H22N2O2S/c25-22(16-24-14-6-11-19(24)21-13-7-15-27-21)23-18-10-4-5-12-20(18)26-17-8-2-1-3-9-17/h1-5,7-10,12-13,15,19H,6,11,14,16H2,(H,23,25)/p+1/t19-/m1/s1 |
| InChIKey | ZQZYCTLSXUJFGH-LJQANCHMSA-O |
| XLogP | 3.90 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |