C19H25N4O3+ — CID 8974960
N-(2,3-dimethyl-6-nitrophenyl)-2-[(2S)-2-(1-methylpyrrol-2-yl)pyrrolidin-1-ium-1-yl]acetamide (PubChem CID 8974960) has the molecular formula C19H25N4O3+ and a molecular weight of 357.43 g/mol. Its IUPAC name is N-(2,3-dimethyl-6-nitrophenyl)-2-[(2S)-2-(1-methylpyrrol-2-yl)pyrrolidin-1-ium-1-yl]acetamide.
| Compound Name | N-(2,3-dimethyl-6-nitrophenyl)-2-[(2S)-2-(1-methylpyrrol-2-yl)pyrrolidin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8974960 |
| Molecular Formula | C19H25N4O3+ |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | N-(2,3-dimethyl-6-nitrophenyl)-2-[(2S)-2-(1-methylpyrrol-2-yl)pyrrolidin-1-ium-1-yl]acetamide |
| SMILES | Cc1ccc([N+](=O)[O-])c(NC(=O)C[NH+]2CCC[C@H]2c2cccn2C)c1C |
| InChI | InChI=1S/C19H24N4O3/c1-13-8-9-17(23(25)26)19(14(13)2)20-18(24)12-22-11-5-7-16(22)15-6-4-10-21(15)3/h4,6,8-10,16H,5,7,11-12H2,1-3H3,(H,20,24)/p+1/t16-/m0/s1 |
| InChIKey | XHCDIXMPEINFOB-INIZCTEOSA-O |
| XLogP | 1.91 |
| TPSA | 81.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|