C19H26N3O3S+ — CID 9135960
methyl 4-[[2-[(2S)-2-(1,3-benzothiazol-2-yl)piperidin-1-ium-1-yl]acetyl]amino]butanoate (PubChem CID 9135960) has the molecular formula C19H26N3O3S+ and a molecular weight of 376.50 g/mol. Its IUPAC name is methyl 4-[[2-[(2S)-2-(1,3-benzothiazol-2-yl)piperidin-1-ium-1-yl]acetyl]amino]butanoate.
| Compound Name | methyl 4-[[2-[(2S)-2-(1,3-benzothiazol-2-yl)piperidin-1-ium-1-yl]acetyl]amino]butanoate |
|---|---|
| PubChem CID | 9135960 |
| Molecular Formula | C19H26N3O3S+ |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | methyl 4-[[2-[(2S)-2-(1,3-benzothiazol-2-yl)piperidin-1-ium-1-yl]acetyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)C[NH+]1CCCC[C@H]1c1nc2ccccc2s1 |
| InChI | InChI=1S/C19H25N3O3S/c1-25-18(24)10-6-11-20-17(23)13-22-12-5-4-8-15(22)19-21-14-7-2-3-9-16(14)26-19/h2-3,7,9,15H,4-6,8,10-13H2,1H3,(H,20,23)/p+1/t15-/m0/s1 |
| InChIKey | CBIAWNBLPXZAMD-HNNXBMFYSA-O |
| XLogP | 1.48 |
| TPSA | 72.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|