C25H31N3O6 — CID 67041259
3-[4-[4-(3-methoxyphenyl)piperazin-1-yl]butyl]-1,3-dihydroindol-2-one;oxalic acid (PubChem CID 67041259) has the molecular formula C25H31N3O6 and a molecular weight of 469.54 g/mol. Its IUPAC name is 3-[4-[4-(3-methoxyphenyl)piperazin-1-yl]butyl]-1,3-dihydroindol-2-one;oxalic acid.
| Compound Name | 3-[4-[4-(3-methoxyphenyl)piperazin-1-yl]butyl]-1,3-dihydroindol-2-one;oxalic acid |
|---|---|
| PubChem CID | 67041259 |
| Molecular Formula | C25H31N3O6 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | 3-[4-[4-(3-methoxyphenyl)piperazin-1-yl]butyl]-1,3-dihydroindol-2-one;oxalic acid |
| SMILES | COc1cccc(N2CCN(CCCCC3C(=O)Nc4ccccc43)CC2)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C23H29N3O2.C2H2O4/c1-28-19-8-6-7-18(17-19)26-15-13-25(14-16-26)12-5-4-10-21-20-9-2-3-11-22(20)24-23(21)27;3-1(4)2(5)6/h2-3,6-9,11,17,21H,4-5,10,12-16H2,1H3,(H,24,27);(H,3,4)(H,5,6) |
| InChIKey | NDERFKLSEAOZMY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 119.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|