C22H25Cl2F2N3O — CID 69114627
3-[4-[4-(3-chloro-4-fluorophenyl)piperazin-1-yl]butyl]-6-fluoro-1,3-dihydroindol-2-one;hydrochloride (PubChem CID 69114627) has the molecular formula C22H25Cl2F2N3O and a molecular weight of 456.36 g/mol. Its IUPAC name is 3-[4-[4-(3-chloro-4-fluorophenyl)piperazin-1-yl]butyl]-6-fluoro-1,3-dihydroindol-2-one;hydrochloride.
| Compound Name | 3-[4-[4-(3-chloro-4-fluorophenyl)piperazin-1-yl]butyl]-6-fluoro-1,3-dihydroindol-2-one;hydrochloride |
|---|---|
| PubChem CID | 69114627 |
| Molecular Formula | C22H25Cl2F2N3O |
| Molecular Weight | 456.36 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 3-[4-[4-(3-chloro-4-fluorophenyl)piperazin-1-yl]butyl]-6-fluoro-1,3-dihydroindol-2-one;hydrochloride |
| SMILES | Cl.O=C1Nc2cc(F)ccc2C1CCCCN1CCN(c2ccc(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C22H24ClF2N3O.ClH/c23-19-14-16(5-7-20(19)25)28-11-9-27(10-12-28)8-2-1-3-18-17-6-4-15(24)13-21(17)26-22(18)29;/h4-7,13-14,18H,1-3,8-12H2,(H,26,29);1H |
| InChIKey | HPRZTMYVCJXRQF-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.36 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|