C22H26ClF2N3O — CID 69114845
6-fluoro-3-[4-[4-(4-fluorophenyl)piperazin-1-yl]butyl]-1,3-dihydroindol-2-one;hydrochloride (PubChem CID 69114845) has the molecular formula C22H26ClF2N3O and a molecular weight of 421.92 g/mol. Its IUPAC name is 6-fluoro-3-[4-[4-(4-fluorophenyl)piperazin-1-yl]butyl]-1,3-dihydroindol-2-one;hydrochloride.
| Compound Name | 6-fluoro-3-[4-[4-(4-fluorophenyl)piperazin-1-yl]butyl]-1,3-dihydroindol-2-one;hydrochloride |
|---|---|
| PubChem CID | 69114845 |
| Molecular Formula | C22H26ClF2N3O |
| Molecular Weight | 421.92 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 6-fluoro-3-[4-[4-(4-fluorophenyl)piperazin-1-yl]butyl]-1,3-dihydroindol-2-one;hydrochloride |
| SMILES | Cl.O=C1Nc2cc(F)ccc2C1CCCCN1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H25F2N3O.ClH/c23-16-4-7-18(8-5-16)27-13-11-26(12-14-27)10-2-1-3-20-19-9-6-17(24)15-21(19)25-22(20)28;/h4-9,15,20H,1-3,10-14H2,(H,25,28);1H |
| InChIKey | ARUMUDXIFBNDRI-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.92 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|