C23H25ClF2N2O — CID 69093201
6-fluoro-3-[4-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]butyl]-1,3-dihydroindol-2-one;hydrochloride (PubChem CID 69093201) has the molecular formula C23H25ClF2N2O and a molecular weight of 418.92 g/mol. Its IUPAC name is 6-fluoro-3-[4-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]butyl]-1,3-dihydroindol-2-one;hydrochloride.
| Compound Name | 6-fluoro-3-[4-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]butyl]-1,3-dihydroindol-2-one;hydrochloride |
|---|---|
| PubChem CID | 69093201 |
| Molecular Formula | C23H25ClF2N2O |
| Molecular Weight | 418.92 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 6-fluoro-3-[4-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]butyl]-1,3-dihydroindol-2-one;hydrochloride |
| SMILES | Cl.O=C1Nc2cc(F)ccc2C1CCCCN1CC=C(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H24F2N2O.ClH/c24-18-6-4-16(5-7-18)17-10-13-27(14-11-17)12-2-1-3-21-20-9-8-19(25)15-22(20)26-23(21)28;/h4-10,15,21H,1-3,11-14H2,(H,26,28);1H |
| InChIKey | VFTGSVYSVUIWIC-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.92 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|