C19H20ClFN2OS — CID 11523737
3-[4-(2-chloro-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)butyl]-6-fluoro-1,3-dihydroindol-2-one (PubChem CID 11523737) has the molecular formula C19H20ClFN2OS and a molecular weight of 378.90 g/mol. Its IUPAC name is 3-[4-(2-chloro-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)butyl]-6-fluoro-1,3-dihydroindol-2-one.
| Compound Name | 3-[4-(2-chloro-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)butyl]-6-fluoro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 11523737 |
| Molecular Formula | C19H20ClFN2OS |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 3-[4-(2-chloro-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)butyl]-6-fluoro-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2cc(F)ccc2C1CCCCN1CCc2sc(Cl)cc2C1 |
| InChI | InChI=1S/C19H20ClFN2OS/c20-18-9-12-11-23(8-6-17(12)25-18)7-2-1-3-15-14-5-4-13(21)10-16(14)22-19(15)24/h4-5,9-10,15H,1-3,6-8,11H2,(H,22,24) |
| InChIKey | UYFGDBHEHUQCMZ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|