C24H27ClFN3O3 — CID 11518248
3-[4-[4-(7-chloro-2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]butyl]-5-fluoro-1,3-dihydroindol-2-one (PubChem CID 11518248) has the molecular formula C24H27ClFN3O3 and a molecular weight of 459.95 g/mol. Its IUPAC name is 3-[4-[4-(7-chloro-2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]butyl]-5-fluoro-1,3-dihydroindol-2-one.
| Compound Name | 3-[4-[4-(7-chloro-2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]butyl]-5-fluoro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 11518248 |
| Molecular Formula | C24H27ClFN3O3 |
| Molecular Weight | 459.95 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 3-[4-[4-(7-chloro-2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]butyl]-5-fluoro-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2ccc(F)cc2C1CCCCN1CCN(c2cc(Cl)cc3c2OCCO3)CC1 |
| InChI | InChI=1S/C24H27ClFN3O3/c25-16-13-21(23-22(14-16)31-11-12-32-23)29-9-7-28(8-10-29)6-2-1-3-18-19-15-17(26)4-5-20(19)27-24(18)30/h4-5,13-15,18H,1-3,6-12H2,(H,27,30) |
| InChIKey | AUMIDOIRKJSHQJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.95 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|