C21H24FN3O2 — CID 14304624
2-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-4H-1,4-benzoxazin-3-one (PubChem CID 14304624) has the molecular formula C21H24FN3O2 and a molecular weight of 369.44 g/mol. Its IUPAC name is 2-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 2-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 14304624 |
| Molecular Formula | C21H24FN3O2 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 2-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1Nc2ccccc2OC1CCCN1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H24FN3O2/c22-16-7-9-17(10-8-16)25-14-12-24(13-15-25)11-3-6-20-21(26)23-18-4-1-2-5-19(18)27-20/h1-2,4-5,7-10,20H,3,6,11-15H2,(H,23,26) |
| InChIKey | YLVJWWBFPHEWHR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |