About 2-[4-[4-[4-(4-fluorophenyl)piperazin-1-yl]butyl]-3-oxo-1,4-benzoxazin-2-yl]ethyl acetate
2-[4-[4-[4-(4-fluorophenyl)piperazin-1-yl]butyl]-3-oxo-1,4-benzoxazin-2-yl]ethyl acetate (PubChem CID 58511883) has the molecular formula C26H32FN3O4
and a molecular weight of 469.56 g/mol. Its IUPAC name is 2-[4-[4-[4-(4-fluorophenyl)piperazin-1-yl]butyl]-3-oxo-1,4-benzoxazin-2-yl]ethyl acetate.
Molecular Properties
| Compound Name | 2-[4-[4-[4-(4-fluorophenyl)piperazin-1-yl]butyl]-3-oxo-1,4-benzoxazin-2-yl]ethyl acetate |
| PubChem CID | 58511883 |
| Molecular Formula | C26H32FN3O4 |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | 2-[4-[4-[4-(4-fluorophenyl)piperazin-1-yl]butyl]-3-oxo-1,4-benzoxazin-2-yl]ethyl acetate |
| SMILES | CC(=O)OCCC1Oc2ccccc2N(CCCCN2CCN(c3ccc(F)cc3)CC2)C1=O |
| InChI | InChI=1S/C26H32FN3O4/c1-20(31)33-19-12-25-26(32)30(23-6-2-3-7-24(23)34-25)14-5-4-13-28-15-17-29(18-16-28)22-10-8-21(27)9-11-22/h2-3,6-11,25H,4-5,12-19H2,1H3 |
| InChIKey | SBFAELIZWBQUGR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[4-[4-(4-fluorophenyl)piperazin-1-yl]butyl]-3-oxo-1,4-benzoxazin-2-yl]ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[4-[4-(4-fluorophenyl)piperazin-1-yl]butyl]-3-oxo-1,4-benzoxazin-2-yl]ethyl acetate?
The IUPAC name of 2-[4-[4-[4-(4-fluorophenyl)piperazin-1-yl]butyl]-3-oxo-1,4-benzoxazin-2-yl]ethyl acetate (CID 58511883) is 2-[4-[4-[4-(4-fluorophenyl)piperazin-1-yl]butyl]-3-oxo-1,4-benzoxazin-2-yl]ethyl acetate.
What is the SMILES notation for 2-[4-[4-[4-(4-fluorophenyl)piperazin-1-yl]butyl]-3-oxo-1,4-benzoxazin-2-yl]ethyl acetate?
The canonical SMILES for 2-[4-[4-[4-(4-fluorophenyl)piperazin-1-yl]butyl]-3-oxo-1,4-benzoxazin-2-yl]ethyl acetate is CC(=O)OCCC1Oc2ccccc2N(CCCCN2CCN(c3ccc(F)cc3)CC2)C1=O.
What is the InChIKey of 2-[4-[4-[4-(4-fluorophenyl)piperazin-1-yl]butyl]-3-oxo-1,4-benzoxazin-2-yl]ethyl acetate?
The InChIKey is SBFAELIZWBQUGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H32FN3O4/c1-20(31)33-19-12-25-26(32)30(23-6-2-3-7-24(23)34-25)14-5-4-13-28-15-17-29(18-16-28)22-10-8-21(27)9-11-22/h2-3,6-11,25H,4-5,12-19H2,1H3.
What are the key properties of 2-[4-[4-[4-(4-fluorophenyl)piperazin-1-yl]butyl]-3-oxo-1,4-benzoxazin-2-yl]ethyl acetate?
2-[4-[4-[4-(4-fluorophenyl)piperazin-1-yl]butyl]-3-oxo-1,4-benzoxazin-2-yl]ethyl acetate has a molecular weight of 469.56 g/mol, XLogP of 3.48, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[4-[4-(4-fluorophenyl)piperazin-1-yl]butyl]-3-oxo-1,4-benzoxazin-2-yl]ethyl acetate is sourced from PubChem (CID 58511883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).