C28H36N4O6 — CID 90675080
1-[2-(dimethylamino)ethyl]-3-[3-(4-phenylpiperazin-1-yl)propyl]quinoline-2,4-dione;oxalic acid (PubChem CID 90675080) has the molecular formula C28H36N4O6 and a molecular weight of 524.62 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethyl]-3-[3-(4-phenylpiperazin-1-yl)propyl]quinoline-2,4-dione;oxalic acid.
| Compound Name | 1-[2-(dimethylamino)ethyl]-3-[3-(4-phenylpiperazin-1-yl)propyl]quinoline-2,4-dione;oxalic acid |
|---|---|
| PubChem CID | 90675080 |
| Molecular Formula | C28H36N4O6 |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | 1-[2-(dimethylamino)ethyl]-3-[3-(4-phenylpiperazin-1-yl)propyl]quinoline-2,4-dione;oxalic acid |
| SMILES | CN(C)CCN1C(=O)C(CCCN2CCN(c3ccccc3)CC2)C(=O)c2ccccc21.O=C(O)C(=O)O |
| InChI | InChI=1S/C26H34N4O2.C2H2O4/c1-27(2)15-20-30-24-13-7-6-11-22(24)25(31)23(26(30)32)12-8-14-28-16-18-29(19-17-28)21-9-4-3-5-10-21;3-1(4)2(5)6/h3-7,9-11,13,23H,8,12,14-20H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | IHRISBIXMDXGRF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 121.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|