C27H35N5O4 — CID 90675099
1-[3-(dimethylamino)propyl]-6-nitro-3-[3-(4-phenylpiperazin-1-yl)propyl]quinoline-2,4-dione (PubChem CID 90675099) has the molecular formula C27H35N5O4 and a molecular weight of 493.61 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propyl]-6-nitro-3-[3-(4-phenylpiperazin-1-yl)propyl]quinoline-2,4-dione.
| Compound Name | 1-[3-(dimethylamino)propyl]-6-nitro-3-[3-(4-phenylpiperazin-1-yl)propyl]quinoline-2,4-dione |
|---|---|
| PubChem CID | 90675099 |
| Molecular Formula | C27H35N5O4 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | 1-[3-(dimethylamino)propyl]-6-nitro-3-[3-(4-phenylpiperazin-1-yl)propyl]quinoline-2,4-dione |
| SMILES | CN(C)CCCN1C(=O)C(CCCN2CCN(c3ccccc3)CC2)C(=O)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C27H35N5O4/c1-28(2)13-7-15-31-25-12-11-22(32(35)36)20-24(25)26(33)23(27(31)34)10-6-14-29-16-18-30(19-17-29)21-8-4-3-5-9-21/h3-5,8-9,11-12,20,23H,6-7,10,13-19H2,1-2H3 |
| InChIKey | NFEGJHZUOISQRL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 90.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|