C30H42N4O2 — CID 90674943
1-[3-(dimethylamino)propyl]-3-[6-(4-phenylpiperazin-1-yl)hexyl]quinoline-2,4-dione (PubChem CID 90674943) has the molecular formula C30H42N4O2 and a molecular weight of 490.69 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propyl]-3-[6-(4-phenylpiperazin-1-yl)hexyl]quinoline-2,4-dione.
| Compound Name | 1-[3-(dimethylamino)propyl]-3-[6-(4-phenylpiperazin-1-yl)hexyl]quinoline-2,4-dione |
|---|---|
| PubChem CID | 90674943 |
| Molecular Formula | C30H42N4O2 |
| Molecular Weight | 490.69 g/mol |
| Exact Mass | 490.33 |
| IUPAC Name | 1-[3-(dimethylamino)propyl]-3-[6-(4-phenylpiperazin-1-yl)hexyl]quinoline-2,4-dione |
| SMILES | CN(C)CCCN1C(=O)C(CCCCCCN2CCN(c3ccccc3)CC2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C30H42N4O2/c1-31(2)18-12-20-34-28-17-10-9-15-26(28)29(35)27(30(34)36)16-8-3-4-11-19-32-21-23-33(24-22-32)25-13-6-5-7-14-25/h5-7,9-10,13-15,17,27H,3-4,8,11-12,16,18-24H2,1-2H3 |
| InChIKey | ITMLYQZWNQXMPI-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.69 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|