C27H35ClN4O2 — CID 90675097
6-chloro-1-[3-(dimethylamino)propyl]-3-[3-(4-phenylpiperazin-1-yl)propyl]quinoline-2,4-dione (PubChem CID 90675097) has the molecular formula C27H35ClN4O2 and a molecular weight of 483.06 g/mol. Its IUPAC name is 6-chloro-1-[3-(dimethylamino)propyl]-3-[3-(4-phenylpiperazin-1-yl)propyl]quinoline-2,4-dione.
| Compound Name | 6-chloro-1-[3-(dimethylamino)propyl]-3-[3-(4-phenylpiperazin-1-yl)propyl]quinoline-2,4-dione |
|---|---|
| PubChem CID | 90675097 |
| Molecular Formula | C27H35ClN4O2 |
| Molecular Weight | 483.06 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | 6-chloro-1-[3-(dimethylamino)propyl]-3-[3-(4-phenylpiperazin-1-yl)propyl]quinoline-2,4-dione |
| SMILES | CN(C)CCCN1C(=O)C(CCCN2CCN(c3ccccc3)CC2)C(=O)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C27H35ClN4O2/c1-29(2)13-7-15-32-25-12-11-21(28)20-24(25)26(33)23(27(32)34)10-6-14-30-16-18-31(19-17-30)22-8-4-3-5-9-22/h3-5,8-9,11-12,20,23H,6-7,10,13-19H2,1-2H3 |
| InChIKey | DDHUHFHROURHFF-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.06 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|