C21H23ClN2O2 — CID 177381129
3-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-3H-2-benzofuran-1-one (PubChem CID 177381129) has the molecular formula C21H23ClN2O2 and a molecular weight of 370.88 g/mol. Its IUPAC name is 3-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-3H-2-benzofuran-1-one.
| Compound Name | 3-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 177381129 |
| Molecular Formula | C21H23ClN2O2 |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 3-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-3H-2-benzofuran-1-one |
| SMILES | O=C1OC(CCCN2CCN(c3cccc(Cl)c3)CC2)c2ccccc21 |
| InChI | InChI=1S/C21H23ClN2O2/c22-16-5-3-6-17(15-16)24-13-11-23(12-14-24)10-4-9-20-18-7-1-2-8-19(18)21(25)26-20/h1-3,5-8,15,20H,4,9-14H2 |
| InChIKey | HMHPLFATTVALPJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |