C30H28ClN3O2 — CID 10815166
1-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-3-fluoren-9-ylidenepyrrolidine-2,5-dione (PubChem CID 10815166) has the molecular formula C30H28ClN3O2 and a molecular weight of 498.03 g/mol. Its IUPAC name is 1-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-3-fluoren-9-ylidenepyrrolidine-2,5-dione.
| Compound Name | 1-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-3-fluoren-9-ylidenepyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 10815166 |
| Molecular Formula | C30H28ClN3O2 |
| Molecular Weight | 498.03 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | 1-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-3-fluoren-9-ylidenepyrrolidine-2,5-dione |
| SMILES | O=C1CC(=C2c3ccccc3-c3ccccc32)C(=O)N1CCCN1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C30H28ClN3O2/c31-21-7-5-8-22(19-21)33-17-15-32(16-18-33)13-6-14-34-28(35)20-27(30(34)36)29-25-11-3-1-9-23(25)24-10-2-4-12-26(24)29/h1-5,7-12,19H,6,13-18,20H2 |
| InChIKey | KPSUCSFDXUGYRG-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.03 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|