C22H29Cl3N4O — CID 19027729
5-amino-1-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-3,4-dihydroquinolin-2-one;dihydrochloride (PubChem CID 19027729) has the molecular formula C22H29Cl3N4O and a molecular weight of 471.86 g/mol. Its IUPAC name is 5-amino-1-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-3,4-dihydroquinolin-2-one;dihydrochloride.
| Compound Name | 5-amino-1-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-3,4-dihydroquinolin-2-one;dihydrochloride |
|---|---|
| PubChem CID | 19027729 |
| Molecular Formula | C22H29Cl3N4O |
| Molecular Weight | 471.86 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 5-amino-1-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-3,4-dihydroquinolin-2-one;dihydrochloride |
| SMILES | Cl.Cl.Nc1cccc2c1CCC(=O)N2CCCN1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C22H27ClN4O.2ClH/c23-17-4-1-5-18(16-17)26-14-12-25(13-15-26)10-3-11-27-21-7-2-6-20(24)19(21)8-9-22(27)28;;/h1-2,4-7,16H,3,8-15,24H2;2*1H |
| InChIKey | JFZWOAWZOMABEL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 52.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.86 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|