C33H43N5O7 — CID 70361519
4-[2-(dimethylamino)ethyl]-1-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylic acid (PubChem CID 70361519) has the molecular formula C33H43N5O7 and a molecular weight of 621.74 g/mol. Its IUPAC name is 4-[2-(dimethylamino)ethyl]-1-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylic acid.
| Compound Name | 4-[2-(dimethylamino)ethyl]-1-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 70361519 |
| Molecular Formula | C33H43N5O7 |
| Molecular Weight | 621.74 g/mol |
| Exact Mass | 621.32 |
| IUPAC Name | 4-[2-(dimethylamino)ethyl]-1-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylic acid |
| SMILES | COc1ccccc1N1CCN(CCCN2C(C)=C(C(=O)O)C(CCN(C)C)(c3cccc([N+](=O)[O-])c3)C(C(=O)O)=C2C)CC1 |
| InChI | InChI=1S/C33H43N5O7/c1-23-29(31(39)40)33(14-17-34(3)4,25-10-8-11-26(22-25)38(43)44)30(32(41)42)24(2)37(23)16-9-15-35-18-20-36(21-19-35)27-12-6-7-13-28(27)45-5/h6-8,10-13,22H,9,14-21H2,1-5H3,(H,39,40)(H,41,42) |
| InChIKey | JHVZWQHWGUOWPR-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 139.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.74 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|