C26H32ClN3O6 — CID 173408739
2-[benzyl(methyl)amino]-4-ethyl-1,2,6-trimethyl-4-(3-nitrophenyl)-3H-pyridine-3,5-dicarboxylic acid;hydrochloride (PubChem CID 173408739) has the molecular formula C26H32ClN3O6 and a molecular weight of 518.01 g/mol. Its IUPAC name is 2-[benzyl(methyl)amino]-4-ethyl-1,2,6-trimethyl-4-(3-nitrophenyl)-3H-pyridine-3,5-dicarboxylic acid;hydrochloride.
| Compound Name | 2-[benzyl(methyl)amino]-4-ethyl-1,2,6-trimethyl-4-(3-nitrophenyl)-3H-pyridine-3,5-dicarboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 173408739 |
| Molecular Formula | C26H32ClN3O6 |
| Molecular Weight | 518.01 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | 2-[benzyl(methyl)amino]-4-ethyl-1,2,6-trimethyl-4-(3-nitrophenyl)-3H-pyridine-3,5-dicarboxylic acid;hydrochloride |
| SMILES | CCC1(c2cccc([N+](=O)[O-])c2)C(C(=O)O)=C(C)N(C)C(C)(N(C)Cc2ccccc2)C1C(=O)O.Cl |
| InChI | InChI=1S/C26H31N3O6.ClH/c1-6-26(19-13-10-14-20(15-19)29(34)35)21(23(30)31)17(2)28(5)25(3,22(26)24(32)33)27(4)16-18-11-8-7-9-12-18;/h7-15,22H,6,16H2,1-5H3,(H,30,31)(H,32,33);1H |
| InChIKey | ZPFZICHKMWHEPI-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 124.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.01 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|