C26H29N3O6 — CID 68952593
2,4,6-trimethyl-4-(3-nitrophenyl)-1-[2-(2-phenylethylamino)ethyl]pyridine-3,5-dicarboxylic acid (PubChem CID 68952593) has the molecular formula C26H29N3O6 and a molecular weight of 479.53 g/mol. Its IUPAC name is 2,4,6-trimethyl-4-(3-nitrophenyl)-1-[2-(2-phenylethylamino)ethyl]pyridine-3,5-dicarboxylic acid.
| Compound Name | 2,4,6-trimethyl-4-(3-nitrophenyl)-1-[2-(2-phenylethylamino)ethyl]pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 68952593 |
| Molecular Formula | C26H29N3O6 |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | 2,4,6-trimethyl-4-(3-nitrophenyl)-1-[2-(2-phenylethylamino)ethyl]pyridine-3,5-dicarboxylic acid |
| SMILES | CC1=C(C(=O)O)C(C)(c2cccc([N+](=O)[O-])c2)C(C(=O)O)=C(C)N1CCNCCc1ccccc1 |
| InChI | InChI=1S/C26H29N3O6/c1-17-22(24(30)31)26(3,20-10-7-11-21(16-20)29(34)35)23(25(32)33)18(2)28(17)15-14-27-13-12-19-8-5-4-6-9-19/h4-11,16,27H,12-15H2,1-3H3,(H,30,31)(H,32,33) |
| InChIKey | QCISPYSTDKBJML-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 133.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|