C28H30N4O9S — CID 19823387
diethyl 1-(2-formamidoethylsulfanyl)-2,6-dimethyl-4,4-bis(3-nitrophenyl)pyridine-3,5-dicarboxylate (PubChem CID 19823387) has the molecular formula C28H30N4O9S and a molecular weight of 598.63 g/mol. Its IUPAC name is diethyl 1-(2-formamidoethylsulfanyl)-2,6-dimethyl-4,4-bis(3-nitrophenyl)pyridine-3,5-dicarboxylate.
| Compound Name | diethyl 1-(2-formamidoethylsulfanyl)-2,6-dimethyl-4,4-bis(3-nitrophenyl)pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 19823387 |
| Molecular Formula | C28H30N4O9S |
| Molecular Weight | 598.63 g/mol |
| Exact Mass | 598.17 |
| IUPAC Name | diethyl 1-(2-formamidoethylsulfanyl)-2,6-dimethyl-4,4-bis(3-nitrophenyl)pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)N(SCCNC=O)C(C)=C(C(=O)OCC)C1(c1cccc([N+](=O)[O-])c1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H30N4O9S/c1-5-40-26(34)24-18(3)30(42-14-13-29-17-33)19(4)25(27(35)41-6-2)28(24,20-9-7-11-22(15-20)31(36)37)21-10-8-12-23(16-21)32(38)39/h7-12,15-17H,5-6,13-14H2,1-4H3,(H,29,33) |
| InChIKey | GHFDSWLYVZUXLN-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 171.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.63 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|