C36H41N3O6 — CID 70110986
1-[3-(3,3-diphenylpropylamino)-2-methylbutan-2-yl]-4-methoxycarbonyl-2,6-dimethyl-4-(3-nitrophenyl)pyridine-3-carboxylic acid (PubChem CID 70110986) has the molecular formula C36H41N3O6 and a molecular weight of 611.74 g/mol. Its IUPAC name is 1-[3-(3,3-diphenylpropylamino)-2-methylbutan-2-yl]-4-methoxycarbonyl-2,6-dimethyl-4-(3-nitrophenyl)pyridine-3-carboxylic acid.
| Compound Name | 1-[3-(3,3-diphenylpropylamino)-2-methylbutan-2-yl]-4-methoxycarbonyl-2,6-dimethyl-4-(3-nitrophenyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 70110986 |
| Molecular Formula | C36H41N3O6 |
| Molecular Weight | 611.74 g/mol |
| Exact Mass | 611.30 |
| IUPAC Name | 1-[3-(3,3-diphenylpropylamino)-2-methylbutan-2-yl]-4-methoxycarbonyl-2,6-dimethyl-4-(3-nitrophenyl)pyridine-3-carboxylic acid |
| SMILES | COC(=O)C1(c2cccc([N+](=O)[O-])c2)C=C(C)N(C(C)(C)C(C)NCCC(c2ccccc2)c2ccccc2)C(C)=C1C(=O)O |
| InChI | InChI=1S/C36H41N3O6/c1-24-23-36(34(42)45-6,29-18-13-19-30(22-29)39(43)44)32(33(40)41)25(2)38(24)35(4,5)26(3)37-21-20-31(27-14-9-7-10-15-27)28-16-11-8-12-17-28/h7-19,22-23,26,31,37H,20-21H2,1-6H3,(H,40,41) |
| InChIKey | KYNKTCHSXAJFST-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 122.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.74 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|