C31H34N2O5 — CID 69024131
[3-(3,3-diphenylpropylamino)-2-methylbutan-2-yl] 3-(3-nitrophenyl)-4-oxopent-2-enoate (PubChem CID 69024131) has the molecular formula C31H34N2O5 and a molecular weight of 514.62 g/mol. Its IUPAC name is [3-(3,3-diphenylpropylamino)-2-methylbutan-2-yl] 3-(3-nitrophenyl)-4-oxopent-2-enoate.
| Compound Name | [3-(3,3-diphenylpropylamino)-2-methylbutan-2-yl] 3-(3-nitrophenyl)-4-oxopent-2-enoate |
|---|---|
| PubChem CID | 69024131 |
| Molecular Formula | C31H34N2O5 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | [3-(3,3-diphenylpropylamino)-2-methylbutan-2-yl] 3-(3-nitrophenyl)-4-oxopent-2-enoate |
| SMILES | CC(=O)C(=CC(=O)OC(C)(C)C(C)NCCC(c1ccccc1)c1ccccc1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C31H34N2O5/c1-22(34)29(26-16-11-17-27(20-26)33(36)37)21-30(35)38-31(3,4)23(2)32-19-18-28(24-12-7-5-8-13-24)25-14-9-6-10-15-25/h5-17,20-21,23,28,32H,18-19H2,1-4H3 |
| InChIKey | ZKMFTKOUCOIXQY-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|