C28H31ClN4O6 — CID 70352005
4-[2-[4-(3-chlorophenyl)piperazin-1-yl]ethyl]-1,2,6-trimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylic acid (PubChem CID 70352005) has the molecular formula C28H31ClN4O6 and a molecular weight of 555.03 g/mol. Its IUPAC name is 4-[2-[4-(3-chlorophenyl)piperazin-1-yl]ethyl]-1,2,6-trimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylic acid.
| Compound Name | 4-[2-[4-(3-chlorophenyl)piperazin-1-yl]ethyl]-1,2,6-trimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 70352005 |
| Molecular Formula | C28H31ClN4O6 |
| Molecular Weight | 555.03 g/mol |
| Exact Mass | 554.19 |
| IUPAC Name | 4-[2-[4-(3-chlorophenyl)piperazin-1-yl]ethyl]-1,2,6-trimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylic acid |
| SMILES | CC1=C(C(=O)O)C(CCN2CCN(c3cccc(Cl)c3)CC2)(c2cccc([N+](=O)[O-])c2)C(C(=O)O)=C(C)N1C |
| InChI | InChI=1S/C28H31ClN4O6/c1-18-24(26(34)35)28(25(27(36)37)19(2)30(18)3,20-6-4-9-23(16-20)33(38)39)10-11-31-12-14-32(15-13-31)22-8-5-7-21(29)17-22/h4-9,16-17H,10-15H2,1-3H3,(H,34,35)(H,36,37) |
| InChIKey | RMSMDIBFUJIMCU-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 127.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.03 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|