C21H31ClN4O2 — CID 86899023
N-[2-[3-[4-(3-chlorophenyl)piperazin-1-yl]propylamino]-2-oxoethyl]cyclopentanecarboxamide (PubChem CID 86899023) has the molecular formula C21H31ClN4O2 and a molecular weight of 406.96 g/mol. Its IUPAC name is N-[2-[3-[4-(3-chlorophenyl)piperazin-1-yl]propylamino]-2-oxoethyl]cyclopentanecarboxamide.
| Compound Name | N-[2-[3-[4-(3-chlorophenyl)piperazin-1-yl]propylamino]-2-oxoethyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 86899023 |
| Molecular Formula | C21H31ClN4O2 |
| Molecular Weight | 406.96 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | N-[2-[3-[4-(3-chlorophenyl)piperazin-1-yl]propylamino]-2-oxoethyl]cyclopentanecarboxamide |
| SMILES | O=C(CNC(=O)C1CCCC1)NCCCN1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C21H31ClN4O2/c22-18-7-3-8-19(15-18)26-13-11-25(12-14-26)10-4-9-23-20(27)16-24-21(28)17-5-1-2-6-17/h3,7-8,15,17H,1-2,4-6,9-14,16H2,(H,23,27)(H,24,28) |
| InChIKey | XOMPJYGPCVMYBB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.96 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|