C15H19Cl2N3O2S — CID 86738729
3-[2-[4-(3-chlorophenyl)piperazin-1-yl]ethyl]-1,3-thiazolidine-2,4-dione;hydrochloride (PubChem CID 86738729) has the molecular formula C15H19Cl2N3O2S and a molecular weight of 376.31 g/mol. Its IUPAC name is 3-[2-[4-(3-chlorophenyl)piperazin-1-yl]ethyl]-1,3-thiazolidine-2,4-dione;hydrochloride.
| Compound Name | 3-[2-[4-(3-chlorophenyl)piperazin-1-yl]ethyl]-1,3-thiazolidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 86738729 |
| Molecular Formula | C15H19Cl2N3O2S |
| Molecular Weight | 376.31 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 3-[2-[4-(3-chlorophenyl)piperazin-1-yl]ethyl]-1,3-thiazolidine-2,4-dione;hydrochloride |
| SMILES | Cl.O=C1CSC(=O)N1CCN1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C15H18ClN3O2S.ClH/c16-12-2-1-3-13(10-12)18-7-4-17(5-8-18)6-9-19-14(20)11-22-15(19)21;/h1-3,10H,4-9,11H2;1H |
| InChIKey | DQDFYYYFAAJPFP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|