C26H36ClF3N2 — CID 66907897
1-[2-(3-hexyl-4-methylphenyl)ethyl]-4-[3-(trifluoromethyl)phenyl]piperazine;hydrochloride (PubChem CID 66907897) has the molecular formula C26H36ClF3N2 and a molecular weight of 469.04 g/mol. Its IUPAC name is 1-[2-(3-hexyl-4-methylphenyl)ethyl]-4-[3-(trifluoromethyl)phenyl]piperazine;hydrochloride.
| Compound Name | 1-[2-(3-hexyl-4-methylphenyl)ethyl]-4-[3-(trifluoromethyl)phenyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 66907897 |
| Molecular Formula | C26H36ClF3N2 |
| Molecular Weight | 469.04 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 1-[2-(3-hexyl-4-methylphenyl)ethyl]-4-[3-(trifluoromethyl)phenyl]piperazine;hydrochloride |
| SMILES | CCCCCCc1cc(CCN2CCN(c3cccc(C(F)(F)F)c3)CC2)ccc1C.Cl |
| InChI | InChI=1S/C26H35F3N2.ClH/c1-3-4-5-6-8-23-19-22(12-11-21(23)2)13-14-30-15-17-31(18-16-30)25-10-7-9-24(20-25)26(27,28)29;/h7,9-12,19-20H,3-6,8,13-18H2,1-2H3;1H |
| InChIKey | FIBOJBAUGNUHEP-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.04 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|