C32H41F3N2O3S — CID 44552876
4-methylbenzenesulfonic acid;1-[2-(4-methyl-3-pentylphenyl)ethyl]-4-[3-(trifluoromethyl)phenyl]piperazine (PubChem CID 44552876) has the molecular formula C32H41F3N2O3S and a molecular weight of 590.75 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;1-[2-(4-methyl-3-pentylphenyl)ethyl]-4-[3-(trifluoromethyl)phenyl]piperazine.
| Compound Name | 4-methylbenzenesulfonic acid;1-[2-(4-methyl-3-pentylphenyl)ethyl]-4-[3-(trifluoromethyl)phenyl]piperazine |
|---|---|
| PubChem CID | 44552876 |
| Molecular Formula | C32H41F3N2O3S |
| Molecular Weight | 590.75 g/mol |
| Exact Mass | 590.28 |
| IUPAC Name | 4-methylbenzenesulfonic acid;1-[2-(4-methyl-3-pentylphenyl)ethyl]-4-[3-(trifluoromethyl)phenyl]piperazine |
| SMILES | CCCCCc1cc(CCN2CCN(c3cccc(C(F)(F)F)c3)CC2)ccc1C.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C25H33F3N2.C7H8O3S/c1-3-4-5-7-22-18-21(11-10-20(22)2)12-13-29-14-16-30(17-15-29)24-9-6-8-23(19-24)25(26,27)28;1-6-2-4-7(5-3-6)11(8,9)10/h6,8-11,18-19H,3-5,7,12-17H2,1-2H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | WJVFIFDKQIXFOG-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.75 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|