C23H26F3N3O3 — CID 88608475
(4Z)-4-hydroxyimino-4-[4-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]phenyl]butanoic acid (PubChem CID 88608475) has the molecular formula C23H26F3N3O3 and a molecular weight of 449.47 g/mol. Its IUPAC name is (4Z)-4-hydroxyimino-4-[4-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]phenyl]butanoic acid.
| Compound Name | (4Z)-4-hydroxyimino-4-[4-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]phenyl]butanoic acid |
|---|---|
| PubChem CID | 88608475 |
| Molecular Formula | C23H26F3N3O3 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | (4Z)-4-hydroxyimino-4-[4-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]phenyl]butanoic acid |
| SMILES | O=C(O)CC/C(=N/O)c1ccc(CCN2CCN(c3cccc(C(F)(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C23H26F3N3O3/c24-23(25,26)19-2-1-3-20(16-19)29-14-12-28(13-15-29)11-10-17-4-6-18(7-5-17)21(27-32)8-9-22(30)31/h1-7,16,32H,8-15H2,(H,30,31)/b27-21- |
| InChIKey | SRIQMOLARLUFQO-MEFGMAGPSA-N |
| XLogP | 4.11 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|