C20H24F3N3O2S — CID 91471972
N-[2-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]phenyl]methanesulfonamide (PubChem CID 91471972) has the molecular formula C20H24F3N3O2S and a molecular weight of 427.49 g/mol. Its IUPAC name is N-[2-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]phenyl]methanesulfonamide.
| Compound Name | N-[2-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 91471972 |
| Molecular Formula | C20H24F3N3O2S |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | N-[2-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccccc1CCN1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C20H24F3N3O2S/c1-29(27,28)24-19-8-3-2-5-16(19)9-10-25-11-13-26(14-12-25)18-7-4-6-17(15-18)20(21,22)23/h2-8,15,24H,9-14H2,1H3 |
| InChIKey | YYKVUXKCBSSKJJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |