C24H13F3N6O2 — CID 140686185
9-(6-isocyano-3-pyridinyl)-3-methyl-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione (PubChem CID 140686185) has the molecular formula C24H13F3N6O2 and a molecular weight of 474.40 g/mol. Its IUPAC name is 9-(6-isocyano-3-pyridinyl)-3-methyl-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione.
| Compound Name | 9-(6-isocyano-3-pyridinyl)-3-methyl-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
|---|---|
| PubChem CID | 140686185 |
| Molecular Formula | C24H13F3N6O2 |
| Molecular Weight | 474.40 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | 9-(6-isocyano-3-pyridinyl)-3-methyl-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
| SMILES | [C-]#[N+]c1ccc(-c2ccc3ncc4c(=O)n(C)c(=O)n(-c5cccc(C(F)(F)F)c5)c4c3n2)cn1 |
| InChI | InChI=1S/C24H13F3N6O2/c1-28-19-9-6-13(11-30-19)17-7-8-18-20(31-17)21-16(12-29-18)22(34)32(2)23(35)33(21)15-5-3-4-14(10-15)24(25,26)27/h3-12H,2H3 |
| InChIKey | BYWZJCRSESLNGX-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 87.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.40 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|