C41H38F3N3O2 — CID 144611338
1-[3-(buta-1,3-dien-2-ylamino)-4-methylphenyl]-9-[4-[[3-(trifluoromethyl)phenoxy]methyl]phenyl]benzo[h][1,6]naphthyridin-2-one;butane (PubChem CID 144611338) has the molecular formula C41H38F3N3O2 and a molecular weight of 661.77 g/mol. Its IUPAC name is 1-[3-(buta-1,3-dien-2-ylamino)-4-methylphenyl]-9-[4-[[3-(trifluoromethyl)phenoxy]methyl]phenyl]benzo[h][1,6]naphthyridin-2-one;butane.
| Compound Name | 1-[3-(buta-1,3-dien-2-ylamino)-4-methylphenyl]-9-[4-[[3-(trifluoromethyl)phenoxy]methyl]phenyl]benzo[h][1,6]naphthyridin-2-one;butane |
|---|---|
| PubChem CID | 144611338 |
| Molecular Formula | C41H38F3N3O2 |
| Molecular Weight | 661.77 g/mol |
| Exact Mass | 661.29 |
| IUPAC Name | 1-[3-(buta-1,3-dien-2-ylamino)-4-methylphenyl]-9-[4-[[3-(trifluoromethyl)phenoxy]methyl]phenyl]benzo[h][1,6]naphthyridin-2-one;butane |
| SMILES | C=CC(=C)Nc1cc(-n2c(=O)ccc3cnc4ccc(-c5ccc(COc6cccc(C(F)(F)F)c6)cc5)cc4c32)ccc1C.CCCC |
| InChI | InChI=1S/C37H28F3N3O2.C4H10/c1-4-24(3)42-34-20-30(15-8-23(34)2)43-35(44)17-14-28-21-41-33-16-13-27(18-32(33)36(28)43)26-11-9-25(10-12-26)22-45-31-7-5-6-29(19-31)37(38,39)40;1-3-4-2/h4-21,42H,1,3,22H2,2H3;3-4H2,1-2H3 |
| InChIKey | BPYIKVOFNLAYPY-UHFFFAOYSA-N |
| XLogP | 11.03 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.77 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|