C38H28F3N3O3 — CID 123792199
1-[4-methyl-3-[1-(oxiran-2-yl)prop-2-enylideneamino]phenyl]-9-[4-[[3-(trifluoromethyl)phenoxy]methyl]phenyl]benzo[h][1,6]naphthyridin-2-one (PubChem CID 123792199) has the molecular formula C38H28F3N3O3 and a molecular weight of 631.65 g/mol. Its IUPAC name is 1-[4-methyl-3-[1-(oxiran-2-yl)prop-2-enylideneamino]phenyl]-9-[4-[[3-(trifluoromethyl)phenoxy]methyl]phenyl]benzo[h][1,6]naphthyridin-2-one.
| Compound Name | 1-[4-methyl-3-[1-(oxiran-2-yl)prop-2-enylideneamino]phenyl]-9-[4-[[3-(trifluoromethyl)phenoxy]methyl]phenyl]benzo[h][1,6]naphthyridin-2-one |
|---|---|
| PubChem CID | 123792199 |
| Molecular Formula | C38H28F3N3O3 |
| Molecular Weight | 631.65 g/mol |
| Exact Mass | 631.21 |
| IUPAC Name | 1-[4-methyl-3-[1-(oxiran-2-yl)prop-2-enylideneamino]phenyl]-9-[4-[[3-(trifluoromethyl)phenoxy]methyl]phenyl]benzo[h][1,6]naphthyridin-2-one |
| SMILES | C=C/C(=N\c1cc(-n2c(=O)ccc3cnc4ccc(-c5ccc(COc6cccc(C(F)(F)F)c6)cc5)cc4c32)ccc1C)C1CO1 |
| InChI | InChI=1S/C38H28F3N3O3/c1-3-32(35-22-47-35)43-34-19-29(14-7-23(34)2)44-36(45)16-13-27-20-42-33-15-12-26(17-31(33)37(27)44)25-10-8-24(9-11-25)21-46-30-6-4-5-28(18-30)38(39,40)41/h3-20,35H,1,21-22H2,2H3/b43-32+ |
| InChIKey | SCUFLERVONOMAI-WUGRJRDASA-N |
| XLogP | 8.77 |
| TPSA | 69.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.65 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|