C19H20N2O — CID 167627861
N-[3-(7-methyl-3,4-dihydro-2H-quinolin-1-yl)phenyl]prop-2-enamide (PubChem CID 167627861) has the molecular formula C19H20N2O and a molecular weight of 292.38 g/mol. Its IUPAC name is N-[3-(7-methyl-3,4-dihydro-2H-quinolin-1-yl)phenyl]prop-2-enamide.
| Compound Name | N-[3-(7-methyl-3,4-dihydro-2H-quinolin-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 167627861 |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | N-[3-(7-methyl-3,4-dihydro-2H-quinolin-1-yl)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(N2CCCc3ccc(C)cc32)c1 |
| InChI | InChI=1S/C19H20N2O/c1-3-19(22)20-16-7-4-8-17(13-16)21-11-5-6-15-10-9-14(2)12-18(15)21/h3-4,7-10,12-13H,1,5-6,11H2,2H3,(H,20,22) |
| InChIKey | NIYQUDXNZNSIMU-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|