C31H30N6O2 — CID 123998871
2-[(2S)-2-[[4-amino-6-methyl-5-(4-phenoxyphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]methyl]pyrrolidine-1-carbonyl]-3-cyclopropylprop-2-enenitrile (PubChem CID 123998871) has the molecular formula C31H30N6O2 and a molecular weight of 518.62 g/mol. Its IUPAC name is 2-[(2S)-2-[[4-amino-6-methyl-5-(4-phenoxyphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]methyl]pyrrolidine-1-carbonyl]-3-cyclopropylprop-2-enenitrile.
| Compound Name | 2-[(2S)-2-[[4-amino-6-methyl-5-(4-phenoxyphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]methyl]pyrrolidine-1-carbonyl]-3-cyclopropylprop-2-enenitrile |
|---|---|
| PubChem CID | 123998871 |
| Molecular Formula | C31H30N6O2 |
| Molecular Weight | 518.62 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | 2-[(2S)-2-[[4-amino-6-methyl-5-(4-phenoxyphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]methyl]pyrrolidine-1-carbonyl]-3-cyclopropylprop-2-enenitrile |
| SMILES | Cc1c(-c2ccc(Oc3ccccc3)cc2)c2c(N)ncnc2n1C[C@@H]1CCCN1C(=O)C(C#N)=CC1CC1 |
| InChI | InChI=1S/C31H30N6O2/c1-20-27(22-11-13-26(14-12-22)39-25-7-3-2-4-8-25)28-29(33)34-19-35-30(28)37(20)18-24-6-5-15-36(24)31(38)23(17-32)16-21-9-10-21/h2-4,7-8,11-14,16,19,21,24H,5-6,9-10,15,18H2,1H3,(H2,33,34,35)/t24-/m0/s1 |
| InChIKey | WNLTXZCOYCXQHU-DEOSSOPVSA-N |
| XLogP | 5.63 |
| TPSA | 110.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.62 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|