C30H26F2N6O2 — CID 72715567
(E)-2-[(2R)-2-[[4-amino-5-[4-(3,5-difluorophenoxy)phenyl]pyrrolo[2,3-d]pyrimidin-7-yl]methyl]pyrrolidine-1-carbonyl]-3-cyclopropylprop-2-enenitrile (PubChem CID 72715567) has the molecular formula C30H26F2N6O2 and a molecular weight of 540.57 g/mol. Its IUPAC name is (E)-2-[(2R)-2-[[4-amino-5-[4-(3,5-difluorophenoxy)phenyl]pyrrolo[2,3-d]pyrimidin-7-yl]methyl]pyrrolidine-1-carbonyl]-3-cyclopropylprop-2-enenitrile.
| Compound Name | (E)-2-[(2R)-2-[[4-amino-5-[4-(3,5-difluorophenoxy)phenyl]pyrrolo[2,3-d]pyrimidin-7-yl]methyl]pyrrolidine-1-carbonyl]-3-cyclopropylprop-2-enenitrile |
|---|---|
| PubChem CID | 72715567 |
| Molecular Formula | C30H26F2N6O2 |
| Molecular Weight | 540.57 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | (E)-2-[(2R)-2-[[4-amino-5-[4-(3,5-difluorophenoxy)phenyl]pyrrolo[2,3-d]pyrimidin-7-yl]methyl]pyrrolidine-1-carbonyl]-3-cyclopropylprop-2-enenitrile |
| SMILES | N#C/C(=C\C1CC1)C(=O)N1CCC[C@@H]1Cn1cc(-c2ccc(Oc3cc(F)cc(F)c3)cc2)c2c(N)ncnc21 |
| InChI | InChI=1S/C30H26F2N6O2/c31-21-11-22(32)13-25(12-21)40-24-7-5-19(6-8-24)26-16-37(29-27(26)28(34)35-17-36-29)15-23-2-1-9-38(23)30(39)20(14-33)10-18-3-4-18/h5-8,10-13,16-18,23H,1-4,9,15H2,(H2,34,35,36)/b20-10+/t23-/m1/s1 |
| InChIKey | FQEGACSJFGTHBB-LICXLWGISA-N |
| XLogP | 5.60 |
| TPSA | 110.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.57 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|