C29H35N7O3 — CID 118114889
5-[[1-[(E)-4-(dimethylamino)but-2-enoyl]piperidin-3-yl]-methylamino]-3-(4-phenoxyanilino)pyrazine-2-carboxamide (PubChem CID 118114889) has the molecular formula C29H35N7O3 and a molecular weight of 529.65 g/mol. Its IUPAC name is 5-[[1-[(E)-4-(dimethylamino)but-2-enoyl]piperidin-3-yl]-methylamino]-3-(4-phenoxyanilino)pyrazine-2-carboxamide.
| Compound Name | 5-[[1-[(E)-4-(dimethylamino)but-2-enoyl]piperidin-3-yl]-methylamino]-3-(4-phenoxyanilino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 118114889 |
| Molecular Formula | C29H35N7O3 |
| Molecular Weight | 529.65 g/mol |
| Exact Mass | 529.28 |
| IUPAC Name | 5-[[1-[(E)-4-(dimethylamino)but-2-enoyl]piperidin-3-yl]-methylamino]-3-(4-phenoxyanilino)pyrazine-2-carboxamide |
| SMILES | CN(C)C/C=C/C(=O)N1CCCC(N(C)c2cnc(C(N)=O)c(Nc3ccc(Oc4ccccc4)cc3)n2)C1 |
| InChI | InChI=1S/C29H35N7O3/c1-34(2)17-8-12-26(37)36-18-7-9-22(20-36)35(3)25-19-31-27(28(30)38)29(33-25)32-21-13-15-24(16-14-21)39-23-10-5-4-6-11-23/h4-6,8,10-16,19,22H,7,9,17-18,20H2,1-3H3,(H2,30,38)(H,32,33)/b12-8+ |
| InChIKey | IWFDWNSVJHPEMV-XYOKQWHBSA-N |
| XLogP | 3.66 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.65 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|