C31H33N5O3 — CID 141475930
8-[1-[(E)-4-(dimethylamino)but-2-enoyl]piperidin-4-yl]-2-(4-phenoxyphenyl)imidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 141475930) has the molecular formula C31H33N5O3 and a molecular weight of 523.64 g/mol. Its IUPAC name is 8-[1-[(E)-4-(dimethylamino)but-2-enoyl]piperidin-4-yl]-2-(4-phenoxyphenyl)imidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | 8-[1-[(E)-4-(dimethylamino)but-2-enoyl]piperidin-4-yl]-2-(4-phenoxyphenyl)imidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 141475930 |
| Molecular Formula | C31H33N5O3 |
| Molecular Weight | 523.64 g/mol |
| Exact Mass | 523.26 |
| IUPAC Name | 8-[1-[(E)-4-(dimethylamino)but-2-enoyl]piperidin-4-yl]-2-(4-phenoxyphenyl)imidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | CN(C)C/C=C/C(=O)N1CCC(c2cccn3c(C(N)=O)c(-c4ccc(Oc5ccccc5)cc4)nc23)CC1 |
| InChI | InChI=1S/C31H33N5O3/c1-34(2)18-7-11-27(37)35-20-16-22(17-21-35)26-10-6-19-36-29(30(32)38)28(33-31(26)36)23-12-14-25(15-13-23)39-24-8-4-3-5-9-24/h3-15,19,22H,16-18,20-21H2,1-2H3,(H2,32,38)/b11-7+ |
| InChIKey | RVJJQDDVNLFJPD-YRNVUSSQSA-N |
| XLogP | 4.72 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.64 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|