C30H36Cl2N6O5S — CID 175360802
3-[5-chloro-2-[5-chloro-2-methoxy-4-(4-morpholin-4-ylpiperidin-1-yl)anilino]pyrimidin-4-yl]indole-1-sulfonic acid;ethane (PubChem CID 175360802) has the molecular formula C30H36Cl2N6O5S and a molecular weight of 663.63 g/mol. Its IUPAC name is 3-[5-chloro-2-[5-chloro-2-methoxy-4-(4-morpholin-4-ylpiperidin-1-yl)anilino]pyrimidin-4-yl]indole-1-sulfonic acid;ethane.
| Compound Name | 3-[5-chloro-2-[5-chloro-2-methoxy-4-(4-morpholin-4-ylpiperidin-1-yl)anilino]pyrimidin-4-yl]indole-1-sulfonic acid;ethane |
|---|---|
| PubChem CID | 175360802 |
| Molecular Formula | C30H36Cl2N6O5S |
| Molecular Weight | 663.63 g/mol |
| Exact Mass | 662.18 |
| IUPAC Name | 3-[5-chloro-2-[5-chloro-2-methoxy-4-(4-morpholin-4-ylpiperidin-1-yl)anilino]pyrimidin-4-yl]indole-1-sulfonic acid;ethane |
| SMILES | CC.COc1cc(N2CCC(N3CCOCC3)CC2)c(Cl)cc1Nc1ncc(Cl)c(-c2cn(S(=O)(=O)O)c3ccccc23)n1 |
| InChI | InChI=1S/C28H30Cl2N6O5S.C2H6/c1-40-26-15-25(35-8-6-18(7-9-35)34-10-12-41-13-11-34)21(29)14-23(26)32-28-31-16-22(30)27(33-28)20-17-36(42(37,38)39)24-5-3-2-4-19(20)24;1-2/h2-5,14-18H,6-13H2,1H3,(H,31,32,33)(H,37,38,39);1-2H3 |
| InChIKey | PXNLGSVYCCJESJ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 122.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.63 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|