C24H21Cl2N5O5S — CID 175162918
3-[5-chloro-2-[5-chloro-2-methoxy-4-(4-oxopiperidin-1-yl)anilino]pyrimidin-4-yl]indole-1-sulfonic acid (PubChem CID 175162918) has the molecular formula C24H21Cl2N5O5S and a molecular weight of 562.44 g/mol. Its IUPAC name is 3-[5-chloro-2-[5-chloro-2-methoxy-4-(4-oxopiperidin-1-yl)anilino]pyrimidin-4-yl]indole-1-sulfonic acid.
| Compound Name | 3-[5-chloro-2-[5-chloro-2-methoxy-4-(4-oxopiperidin-1-yl)anilino]pyrimidin-4-yl]indole-1-sulfonic acid |
|---|---|
| PubChem CID | 175162918 |
| Molecular Formula | C24H21Cl2N5O5S |
| Molecular Weight | 562.44 g/mol |
| Exact Mass | 561.06 |
| IUPAC Name | 3-[5-chloro-2-[5-chloro-2-methoxy-4-(4-oxopiperidin-1-yl)anilino]pyrimidin-4-yl]indole-1-sulfonic acid |
| SMILES | COc1cc(N2CCC(=O)CC2)c(Cl)cc1Nc1ncc(Cl)c(-c2cn(S(=O)(=O)O)c3ccccc23)n1 |
| InChI | InChI=1S/C24H21Cl2N5O5S/c1-36-22-11-21(30-8-6-14(32)7-9-30)17(25)10-19(22)28-24-27-12-18(26)23(29-24)16-13-31(37(33,34)35)20-5-3-2-4-15(16)20/h2-5,10-13H,6-9H2,1H3,(H,27,28,29)(H,33,34,35) |
| InChIKey | RTTXSHSYMRBQLV-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.44 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|