C31H27ClN6O5S — CID 71239353
4-[1-(benzenesulfonyl)indol-3-yl]-5-chloro-N-[2-methoxy-4-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-nitrophenyl]pyrimidin-2-amine (PubChem CID 71239353) has the molecular formula C31H27ClN6O5S and a molecular weight of 631.11 g/mol. Its IUPAC name is 4-[1-(benzenesulfonyl)indol-3-yl]-5-chloro-N-[2-methoxy-4-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-nitrophenyl]pyrimidin-2-amine.
| Compound Name | 4-[1-(benzenesulfonyl)indol-3-yl]-5-chloro-N-[2-methoxy-4-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-nitrophenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 71239353 |
| Molecular Formula | C31H27ClN6O5S |
| Molecular Weight | 631.11 g/mol |
| Exact Mass | 630.15 |
| IUPAC Name | 4-[1-(benzenesulfonyl)indol-3-yl]-5-chloro-N-[2-methoxy-4-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-nitrophenyl]pyrimidin-2-amine |
| SMILES | COc1cc(C2=CCN(C)CC2)c([N+](=O)[O-])cc1Nc1ncc(Cl)c(-c2cn(S(=O)(=O)c3ccccc3)c3ccccc23)n1 |
| InChI | InChI=1S/C31H27ClN6O5S/c1-36-14-12-20(13-15-36)23-16-29(43-2)26(17-28(23)38(39)40)34-31-33-18-25(32)30(35-31)24-19-37(27-11-7-6-10-22(24)27)44(41,42)21-8-4-3-5-9-21/h3-12,16-19H,13-15H2,1-2H3,(H,33,34,35) |
| InChIKey | ZXGTWJNMWMBMSI-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 132.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.11 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|