C28H20ClN7O4S — CID 170699239
4-[1-(benzenesulfonyl)indol-3-yl]-5-chloro-N-[5-[(4-nitrophenyl)methyl]-1H-pyrazol-3-yl]pyrimidin-2-amine (PubChem CID 170699239) has the molecular formula C28H20ClN7O4S and a molecular weight of 586.03 g/mol. Its IUPAC name is 4-[1-(benzenesulfonyl)indol-3-yl]-5-chloro-N-[5-[(4-nitrophenyl)methyl]-1H-pyrazol-3-yl]pyrimidin-2-amine.
| Compound Name | 4-[1-(benzenesulfonyl)indol-3-yl]-5-chloro-N-[5-[(4-nitrophenyl)methyl]-1H-pyrazol-3-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 170699239 |
| Molecular Formula | C28H20ClN7O4S |
| Molecular Weight | 586.03 g/mol |
| Exact Mass | 585.10 |
| IUPAC Name | 4-[1-(benzenesulfonyl)indol-3-yl]-5-chloro-N-[5-[(4-nitrophenyl)methyl]-1H-pyrazol-3-yl]pyrimidin-2-amine |
| SMILES | O=[N+]([O-])c1ccc(Cc2cc(Nc3ncc(Cl)c(-c4cn(S(=O)(=O)c5ccccc5)c5ccccc45)n3)n[nH]2)cc1 |
| InChI | InChI=1S/C28H20ClN7O4S/c29-24-16-30-28(31-26-15-19(33-34-26)14-18-10-12-20(13-11-18)36(37)38)32-27(24)23-17-35(25-9-5-4-8-22(23)25)41(39,40)21-6-2-1-3-7-21/h1-13,15-17H,14H2,(H2,30,31,32,33,34) |
| InChIKey | VLJSAWREPTVMAL-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 148.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.03 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|