C32H28ClN5O5S — CID 159555060
N-[3-[[4-[1-(benzenesulfonyl)indol-3-yl]-5-chloropyrimidin-2-yl]methyl]cyclohexyl]-4-nitrobenzamide (PubChem CID 159555060) has the molecular formula C32H28ClN5O5S and a molecular weight of 630.13 g/mol. Its IUPAC name is N-[3-[[4-[1-(benzenesulfonyl)indol-3-yl]-5-chloropyrimidin-2-yl]methyl]cyclohexyl]-4-nitrobenzamide.
| Compound Name | N-[3-[[4-[1-(benzenesulfonyl)indol-3-yl]-5-chloropyrimidin-2-yl]methyl]cyclohexyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 159555060 |
| Molecular Formula | C32H28ClN5O5S |
| Molecular Weight | 630.13 g/mol |
| Exact Mass | 629.15 |
| IUPAC Name | N-[3-[[4-[1-(benzenesulfonyl)indol-3-yl]-5-chloropyrimidin-2-yl]methyl]cyclohexyl]-4-nitrobenzamide |
| SMILES | O=C(NC1CCCC(Cc2ncc(Cl)c(-c3cn(S(=O)(=O)c4ccccc4)c4ccccc34)n2)C1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C32H28ClN5O5S/c33-28-19-34-30(18-21-7-6-8-23(17-21)35-32(39)22-13-15-24(16-14-22)38(40)41)36-31(28)27-20-37(29-12-5-4-11-26(27)29)44(42,43)25-9-2-1-3-10-25/h1-5,9-16,19-21,23H,6-8,17-18H2,(H,35,39) |
| InChIKey | XPYLAQMTMSQGOI-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 137.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.13 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|