C24H23Cl2N5O2S — CID 118034036
cis-(1S,3R)-3-N-[4-[1-(benzenesulfonyl)indol-3-yl]-5-chloropyrimidin-2-yl]-1-N-chlorocyclohexane-1,3-diamine (PubChem CID 118034036) has the molecular formula C24H23Cl2N5O2S and a molecular weight of 516.45 g/mol. Its IUPAC name is cis-(1S,3R)-3-N-[4-[1-(benzenesulfonyl)indol-3-yl]-5-chloropyrimidin-2-yl]-1-N-chlorocyclohexane-1,3-diamine.
| Compound Name | cis-(1S,3R)-3-N-[4-[1-(benzenesulfonyl)indol-3-yl]-5-chloropyrimidin-2-yl]-1-N-chlorocyclohexane-1,3-diamine |
|---|---|
| PubChem CID | 118034036 |
| Molecular Formula | C24H23Cl2N5O2S |
| Molecular Weight | 516.45 g/mol |
| Exact Mass | 515.09 |
| IUPAC Name | cis-(1S,3R)-3-N-[4-[1-(benzenesulfonyl)indol-3-yl]-5-chloropyrimidin-2-yl]-1-N-chlorocyclohexane-1,3-diamine |
| SMILES | O=S(=O)(c1ccccc1)n1cc(-c2nc(N[C@@H]3CCC[C@H](NCl)C3)ncc2Cl)c2ccccc21 |
| InChI | InChI=1S/C24H23Cl2N5O2S/c25-21-14-27-24(28-16-7-6-8-17(13-16)30-26)29-23(21)20-15-31(22-12-5-4-11-19(20)22)34(32,33)18-9-2-1-3-10-18/h1-5,9-12,14-17,30H,6-8,13H2,(H,27,28,29)/t16-,17+/m1/s1 |
| InChIKey | PLEOXUVMWQKTBR-SJORKVTESA-N |
| XLogP | 5.46 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.45 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|