C30H28ClN5O3S — CID 134543921
N-[3-(4-aminophenoxy)cyclohexyl]-4-[1-(benzenesulfonyl)indol-3-yl]-5-chloropyrimidin-2-amine (PubChem CID 134543921) has the molecular formula C30H28ClN5O3S and a molecular weight of 574.11 g/mol. Its IUPAC name is N-[3-(4-aminophenoxy)cyclohexyl]-4-[1-(benzenesulfonyl)indol-3-yl]-5-chloropyrimidin-2-amine.
| Compound Name | N-[3-(4-aminophenoxy)cyclohexyl]-4-[1-(benzenesulfonyl)indol-3-yl]-5-chloropyrimidin-2-amine |
|---|---|
| PubChem CID | 134543921 |
| Molecular Formula | C30H28ClN5O3S |
| Molecular Weight | 574.11 g/mol |
| Exact Mass | 573.16 |
| IUPAC Name | N-[3-(4-aminophenoxy)cyclohexyl]-4-[1-(benzenesulfonyl)indol-3-yl]-5-chloropyrimidin-2-amine |
| SMILES | Nc1ccc(OC2CCCC(Nc3ncc(Cl)c(-c4cn(S(=O)(=O)c5ccccc5)c5ccccc45)n3)C2)cc1 |
| InChI | InChI=1S/C30H28ClN5O3S/c31-27-18-33-30(34-21-7-6-8-23(17-21)39-22-15-13-20(32)14-16-22)35-29(27)26-19-36(28-12-5-4-11-25(26)28)40(37,38)24-9-2-1-3-10-24/h1-5,9-16,18-19,21,23H,6-8,17,32H2,(H,33,34,35) |
| InChIKey | GYSHBCRWMXVZGJ-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.11 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|