C29H27ClN6O2S — CID 118025282
N-[1-[(4-aminophenyl)methyl]pyrrolidin-3-yl]-4-[1-(benzenesulfonyl)indol-3-yl]-5-chloropyrimidin-2-amine (PubChem CID 118025282) has the molecular formula C29H27ClN6O2S and a molecular weight of 559.10 g/mol. Its IUPAC name is N-[1-[(4-aminophenyl)methyl]pyrrolidin-3-yl]-4-[1-(benzenesulfonyl)indol-3-yl]-5-chloropyrimidin-2-amine.
| Compound Name | N-[1-[(4-aminophenyl)methyl]pyrrolidin-3-yl]-4-[1-(benzenesulfonyl)indol-3-yl]-5-chloropyrimidin-2-amine |
|---|---|
| PubChem CID | 118025282 |
| Molecular Formula | C29H27ClN6O2S |
| Molecular Weight | 559.10 g/mol |
| Exact Mass | 558.16 |
| IUPAC Name | N-[1-[(4-aminophenyl)methyl]pyrrolidin-3-yl]-4-[1-(benzenesulfonyl)indol-3-yl]-5-chloropyrimidin-2-amine |
| SMILES | Nc1ccc(CN2CCC(Nc3ncc(Cl)c(-c4cn(S(=O)(=O)c5ccccc5)c5ccccc45)n3)C2)cc1 |
| InChI | InChI=1S/C29H27ClN6O2S/c30-26-16-32-29(33-22-14-15-35(18-22)17-20-10-12-21(31)13-11-20)34-28(26)25-19-36(27-9-5-4-8-24(25)27)39(37,38)23-6-2-1-3-7-23/h1-13,16,19,22H,14-15,17-18,31H2,(H,32,33,34) |
| InChIKey | PWTMYEKSCRJTON-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.10 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|