C28H25ClN6O4S2 — CID 118025152
N-[1-(4-aminophenyl)sulfonylpyrrolidin-3-yl]-4-[1-(benzenesulfonyl)indol-3-yl]-5-chloropyrimidin-2-amine (PubChem CID 118025152) has the molecular formula C28H25ClN6O4S2 and a molecular weight of 609.13 g/mol. Its IUPAC name is N-[1-(4-aminophenyl)sulfonylpyrrolidin-3-yl]-4-[1-(benzenesulfonyl)indol-3-yl]-5-chloropyrimidin-2-amine.
| Compound Name | N-[1-(4-aminophenyl)sulfonylpyrrolidin-3-yl]-4-[1-(benzenesulfonyl)indol-3-yl]-5-chloropyrimidin-2-amine |
|---|---|
| PubChem CID | 118025152 |
| Molecular Formula | C28H25ClN6O4S2 |
| Molecular Weight | 609.13 g/mol |
| Exact Mass | 608.11 |
| IUPAC Name | N-[1-(4-aminophenyl)sulfonylpyrrolidin-3-yl]-4-[1-(benzenesulfonyl)indol-3-yl]-5-chloropyrimidin-2-amine |
| SMILES | Nc1ccc(S(=O)(=O)N2CCC(Nc3ncc(Cl)c(-c4cn(S(=O)(=O)c5ccccc5)c5ccccc45)n3)C2)cc1 |
| InChI | InChI=1S/C28H25ClN6O4S2/c29-25-16-31-28(32-20-14-15-34(17-20)40(36,37)22-12-10-19(30)11-13-22)33-27(25)24-18-35(26-9-5-4-8-23(24)26)41(38,39)21-6-2-1-3-7-21/h1-13,16,18,20H,14-15,17,30H2,(H,31,32,33) |
| InChIKey | QOLFRIGZCGBDIR-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 140.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.13 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|