C30H32ClN5O4S — CID 144940897
tert-butyl N-[(1S)-3-[(E)-[4-[1-(benzenesulfonyl)indol-3-yl]-5-chloropyrimidin-2-yl]iminomethyl]cyclohexyl]carbamate (PubChem CID 144940897) has the molecular formula C30H32ClN5O4S and a molecular weight of 594.14 g/mol. Its IUPAC name is tert-butyl N-[(1S)-3-[(E)-[4-[1-(benzenesulfonyl)indol-3-yl]-5-chloropyrimidin-2-yl]iminomethyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-3-[(E)-[4-[1-(benzenesulfonyl)indol-3-yl]-5-chloropyrimidin-2-yl]iminomethyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 144940897 |
| Molecular Formula | C30H32ClN5O4S |
| Molecular Weight | 594.14 g/mol |
| Exact Mass | 593.19 |
| IUPAC Name | tert-butyl N-[(1S)-3-[(E)-[4-[1-(benzenesulfonyl)indol-3-yl]-5-chloropyrimidin-2-yl]iminomethyl]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCCC(/C=N/c2ncc(Cl)c(-c3cn(S(=O)(=O)c4ccccc4)c4ccccc34)n2)C1 |
| InChI | InChI=1S/C30H32ClN5O4S/c1-30(2,3)40-29(37)34-21-11-9-10-20(16-21)17-32-28-33-18-25(31)27(35-28)24-19-36(26-15-8-7-14-23(24)26)41(38,39)22-12-5-4-6-13-22/h4-8,12-15,17-21H,9-11,16H2,1-3H3,(H,34,37)/b32-17+/t20?,21-/m0/s1 |
| InChIKey | KLTVJQORPUTASC-IJFYMLFGSA-N |
| XLogP | 6.77 |
| TPSA | 115.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.14 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|