C26H29ClN4O2S — CID 144832696
4-[1-(benzenesulfonyl)indol-3-yl]-5-chloro-N-octan-4-ylpyrimidin-2-amine (PubChem CID 144832696) has the molecular formula C26H29ClN4O2S and a molecular weight of 497.06 g/mol. Its IUPAC name is 4-[1-(benzenesulfonyl)indol-3-yl]-5-chloro-N-octan-4-ylpyrimidin-2-amine.
| Compound Name | 4-[1-(benzenesulfonyl)indol-3-yl]-5-chloro-N-octan-4-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 144832696 |
| Molecular Formula | C26H29ClN4O2S |
| Molecular Weight | 497.06 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 4-[1-(benzenesulfonyl)indol-3-yl]-5-chloro-N-octan-4-ylpyrimidin-2-amine |
| SMILES | CCCCC(CCC)Nc1ncc(Cl)c(-c2cn(S(=O)(=O)c3ccccc3)c3ccccc23)n1 |
| InChI | InChI=1S/C26H29ClN4O2S/c1-3-5-12-19(11-4-2)29-26-28-17-23(27)25(30-26)22-18-31(24-16-10-9-15-21(22)24)34(32,33)20-13-7-6-8-14-20/h6-10,13-19H,3-5,11-12H2,1-2H3,(H,28,29,30) |
| InChIKey | COMPNPMLTXKGSG-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.06 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |